On Target NS5B_HCV1B 0.05042017/CHEMBL3645193
For the given ligand erastin, we have found in our database that, being scored 0.05042017, the most similar ligand is CHEMBL3645193. Check out the elaboration below.
| erastin (Given Ligand) | CHEMBL3645193 (Similar Ligand) |
|---|---|
| CC(C)/C1=C/C(C)CC(C)C1 | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)c3ncoc3C)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000402 00000000 00100000 00000000 40000000 00020000 00000000 00000400 00000000 00000000 00000020 00002000 00000001 00000000 00000000 00008000 00000010 00200000 00000000 00404000 80000000 00000000 00000000 24020000 00000000 | 00004006 0080de18 20180902 51310e10 210d0001 0010c042 02050400 02003419 00104900 004909f0 09392024 40118c02 80008c33 01600201 808a4440 240e200e 04268000 02010006 08602008 40225203 e4120101 1c8b8e38 2080c800 9770001c 02144084 e0004048 04274080 9804108c 0c488104 0046005b e4068088 a81147e0 |