On Target PR_FCoV 0.18309858/CHEMBL4214471
For the given ligand Sofosbuvir, we have found in our database that, being scored 0.18309858, the most similar ligand is CHEMBL4214471. Check out the elaboration below.
| Sofosbuvir (Given Ligand) | CHEMBL4214471 (Similar Ligand) |
|---|---|
| CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@H]2O[C@@H](n1ccc(=O)[nH]c1=O)[C@](C)(F)[C@@H]2O)Oc3ccccc3 | CC(C)C[C@H](NC(=O)OC1(Cc2ccccc2)CCN(S(C)(=O)=O)CC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00200002 01540108 38100910 83010f40 40180074 00084140 02024413 80000020 0f004100 818008f4 0c00100c 4845b168 00009002 03ca0130 00a89080 009c8a8c 002a0030 00008001 29c60000 00025043 a00801a0 1e000a10 27800041 08700010 10040400 c0202002 2f0012a0 10078060 22005281 09460034 55680020 20139684 | 00030000 01403000 00100102 05310600 00000040 00018010 20000001 20000048 00b00a00 004a08c0 08302000 5003b000 0e00801a 00202101 81440000 001a0008 08220000 02480000 04802810 00004205 00000100 38040e70 01000081 12500018 02000001 80041002 00000000 1020002c 08000200 00060007 a0004000 00812670 |