On Target PR_FCoV 0.15425532/CHEMBL4214471
For the given ligand Niclosamide, we have found in our database that, being scored 0.15425532, the most similar ligand is CHEMBL4214471. Check out the elaboration below.
| Niclosamide (Given Ligand) | CHEMBL4214471 (Similar Ligand) |
|---|---|
| O=C(Nc1ccc(N(=O)=O)cc1Cl)c2cc(Cl)ccc2O | CC(C)C[C@H](NC(=O)OC1(Cc2ccccc2)CCN(S(C)(=O)=O)CC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 0000c002 08001808 20000100 00010e00 00000100 00020000 0e000000 0a001400 04000000 00000868 04280004 4000c800 02018806 00100001 80100040 00002008 10040000 02000000 08000000 00020000 40100000 08068700 20012000 00410004 00002000 c0000400 00100000 800000a0 00008100 00060801 84040000 00020200 | 00030000 01403000 00100102 05310600 00000040 00018010 20000001 20000048 00b00a00 004a08c0 08302000 5003b000 0e00801a 00202101 81440000 001a0008 08220000 02480000 04802810 00004205 00000100 38040e70 01000081 12500018 02000001 80041002 00000000 1020002c 08000200 00060007 a0004000 00812670 |