On Target PA_INFA 0.4375/CHEMBL4440338
For the given ligand Brequinar, we have found in our database that, being scored 0.4375, the most similar ligand is CHEMBL4440338. Check out the elaboration below.
| Brequinar (Given Ligand) | CHEMBL4440338 (Similar Ligand) |
|---|---|
| Cc4c(c2ccc(c1ccccc1F)cc2)nc3ccc(F)cc3c4C(=O)O | O=C(O)c1cccc(-c2cc(=O)c(O)c(C(=O)O)[nH]2)c1 |
|
|
|
|
|
|
| 00002002 00001801 00104100 12010210 00041020 0000c030 00000000 00080004 00400100 10000840 00008004 50008800 80008800 00609000 20220040 0a0c000d 00020200 02003204 04200000 50500000 40000000 08028a28 30800000 80400004 00040000 80000000 08000040 00000041 10414004 00028400 c0040800 00000220 | 00002002 00000808 60004100 10010200 00040029 00024004 00800000 00280840 02000300 10000840 00088004 40008000 00008814 00500001 00020000 0a0c220c 00068000 02807000 04200000 40420000 40000008 08028a20 30802002 00500004 00002400 80000080 00020070 00041041 30034004 09221401 c0000880 40000000 |