On Target PA_INFA 0.3897059/CHEMBL2070214
For the given ligand Niclosamide, we have found in our database that, being scored 0.3897059, the most similar ligand is CHEMBL2070214. Check out the elaboration below.
| Niclosamide (Given Ligand) | CHEMBL2070214 (Similar Ligand) |
|---|---|
| O=C(Nc1ccc(N(=O)=O)cc1Cl)c2cc(Cl)ccc2O | O=C(NCCc1ccc(O)c(O)c1)c1cc2cc(O)c(O)cc2[nH]1 |
|
|
|
|
|
|
| 0000c002 08001808 20000100 00010e00 00000100 00020000 0e000000 0a001400 04000000 00000868 04280004 4000c800 02018806 00100001 80100040 00002008 10040000 02000000 08000000 00020000 40100000 08068700 20012000 00410004 00002000 c0000400 00100000 800000a0 00008100 00060801 84040000 00020200 | 00000002 42009808 20100100 10010e00 00040020 80100000 06000000 02003005 00000080 00080840 08290004 40008000 00008806 00500000 00020440 0204810c 00000000 02000006 00200000 00060200 40000000 18278608 20802000 8140001c 00102000 c0000000 00120000 80000000 04000104 00060003 a0040200 00244600 |