On Target DPM_HHV1K 0.2638298/CHEMBL479371
For the given ligand Brequinar, we have found in our database that, being scored 0.2638298, the most similar ligand is CHEMBL479371. Check out the elaboration below.
| Brequinar (Given Ligand) | CHEMBL479371 (Similar Ligand) |
|---|---|
| Cc4c(c2ccc(c1ccccc1F)cc2)nc3ccc(F)cc3c4C(=O)O | CN(Cc1cc2c(=O)c(C(=O)NCc3ccc(Cl)cc3)cn(C)c2o1)C[C@@H](O)c1ccccn1 |
|
|
|
|
|
|
| 00002002 00001801 00104100 12010210 00041020 0000c030 00000000 00080004 00400100 10000840 00008004 50008800 80008800 00609000 20220040 0a0c000d 00020200 02003204 04200000 50500000 40000000 08028a28 30800000 80400004 00040000 80000000 08000040 00000041 10414004 00028400 c0040800 00000220 | 1401818a 00a2d800 00184120 10014610 040416a3 80004000 00004400 42281200 020843e1 80080ad0 09208434 4081b802 c6009c6e 01600188 01020460 020c040c 1002e000 ca804004 02200080 08000200 c0000000 1a268f30 22a04002 a158001c 10843020 e0000002 0c940054 98040000 04402104 03860043 e0140000 a0020600 |