On Target DPM_HHV1K 0.23348017/CHEMBL481172
For the given ligand Niclosamide, we have found in our database that, being scored 0.23348017, the most similar ligand is CHEMBL481172. Check out the elaboration below.
| Niclosamide (Given Ligand) | CHEMBL481172 (Similar Ligand) |
|---|---|
| O=C(Nc1ccc(N(=O)=O)cc1Cl)c2cc(Cl)ccc2O | CN(Cc1cc2c(=O)c(C(=O)NCc3ccc(Cl)cc3)cn(C)c2o1)C[C@@H](O)c1ccco1 |
|
|
|
|
|
|
| 0000c002 08001808 20000100 00010e00 00000100 00020000 0e000000 0a001400 04000000 00000868 04280004 4000c800 02018806 00100001 80100040 00002008 10040000 02000000 08000000 00020000 40100000 08068700 20012000 00410004 00002000 c0000400 00100000 800000a0 00008100 00060801 84040000 00020200 | 1041818a 00a2d800 80184101 00014610 04041683 80004000 00004400 4a281200 020841e1 800808d0 01200434 4001b802 c6089c6e 01600188 00004460 000c040c 10026000 c200c004 02200080 08000200 c0000000 1a268f10 22a04000 a159001c 30842070 e0000402 0c940054 98040000 24402101 03860043 e0140000 80020600 |