On Target PR_HIV1 0.1764706/CHEMBL503401
For the given ligand Niclosamide, we have found in our database that, being scored 0.1764706, the most similar ligand is CHEMBL503401. Check out the elaboration below.
| Niclosamide (Given Ligand) | CHEMBL503401 (Similar Ligand) |
|---|---|
| O=C(Nc1ccc(N(=O)=O)cc1Cl)c2cc(Cl)ccc2O | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCOCOCCOC2)cc1 |
|
|
|
|
|
|
| 0000c002 08001808 20000100 00010e00 00000100 00020000 0e000000 0a001400 04000000 00000868 04280004 4000c800 02018806 00100001 80100040 00002008 10040000 02000000 08000000 00020000 40100000 08068700 20012000 00410004 00002000 c0000400 00100000 800000a0 00008100 00060801 84040000 00020200 | 00000010 01c05409 2110050a 01b10600 000810c0 00028000 02002000 28000044 00742a00 014809e0 08302000 60018010 00008002 00200001 81e80001 003a8008 10022000 02080000 01400800 01027603 80100120 18280c90 07100040 d9500058 02000400 8000000e 00800000 342000ec 04000600 20060013 80000000 00012670 |