On Target NS5B_HCV1A 0.30697674/CHEMBL353549
For the given ligand Brequinar, we have found in our database that, being scored 0.30697674, the most similar ligand is CHEMBL353549. Check out the elaboration below.
| Brequinar (Given Ligand) | CHEMBL353549 (Similar Ligand) |
|---|---|
| Cc4c(c2ccc(c1ccccc1F)cc2)nc3ccc(F)cc3c4C(=O)O | O=C(N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)c1ccc2c(c1)nc(-c1ccoc1)n2C1CCCCC1 |
|
|
|
|
|
|
| 00002002 00001801 00104100 12010210 00041020 0000c030 00000000 00080004 00400100 10000840 00008004 50008800 80008800 00609000 20220040 0a0c000d 00020200 02003204 04200000 50500000 40000000 08028a28 30800000 80400004 00040000 80000000 08000040 00000041 10414004 00028400 c0040800 00000220 | 0000800a 0120f890 00180100 51850612 200c10e1 00006000 00002000 0220100c 00424980 900918c0 0d30800c 4001b000 5e009c02 00c08800 000204c0 028c000c 10000008 02002004 02e02408 00400201 c0120100 38268e38 23800041 9158001c 00047801 c0004000 08400050 98800000 04400104 04460c43 e00cca00 000006a0 |