On Target NS5B_HCV1B 0.32017544/CHEMBL213832
For the given ligand Brequinar, we have found in our database that, being scored 0.32017544, the most similar ligand is CHEMBL213832. Check out the elaboration below.
| Brequinar (Given Ligand) | CHEMBL213832 (Similar Ligand) |
|---|---|
| Cc4c(c2ccc(c1ccccc1F)cc2)nc3ccc(F)cc3c4C(=O)O | CN(C)C(=O)Cn1c(-c2ccccc2)c(C2CCCCC2)c2sc(C(=O)O)cc21 |
|
|
|
|
|
|
| 00002002 00001801 00104100 12010210 00041020 0000c030 00000000 00080004 00400100 10000840 00008004 50008800 80008800 00609000 20220040 0a0c000d 00020200 02003204 04200000 50500000 40000000 08028a28 30800000 80400004 00040000 80000000 08000040 00000041 10414004 00028400 c0040800 00000220 | 000360c2 2d001801 00100912 51810618 201e5121 0000c100 00002080 00094004 20600900 100808c0 08300a04 4003a080 88008818 00e09801 204a3d20 0c0c000c 11134000 c280209c 06202400 00514013 00102100 78868ef0 30904080 90500016 0a842001 c4000009 08010000 90000044 0a044c06 00061453 c0020a40 00c11e20 |