On Target PR_SARS 0.24358974/CHEMBL221366
For the given ligand Brequinar, we have found in our database that, being scored 0.24358974, the most similar ligand is CHEMBL221366. Check out the elaboration below.
| Brequinar (Given Ligand) | CHEMBL221366 (Similar Ligand) |
|---|---|
| Cc4c(c2ccc(c1ccccc1F)cc2)nc3ccc(F)cc3c4C(=O)O | O=C(Oc1cccnc1)c1cccs1 |
|
|
|
|
|
|
| 00002002 00001801 00104100 12010210 00041020 0000c030 00000000 00080004 00400100 10000840 00008004 50008800 80008800 00609000 20220040 0a0c000d 00020200 02003204 04200000 50500000 40000000 08028a28 30800000 80400004 00040000 80000000 08000040 00000041 10414004 00028400 c0040800 00000220 | 04010042 04000808 60004108 20000200 00041040 04004084 00080080 00200000 00000100 00000040 00000204 40048080 00808814 08010000 01032000 060c000c 09030000 02002008 00200000 00020010 40002060 48008a80 30900000 10c09004 02002400 04082000 00000200 80000004 00000200 00020000 c0000000 10c10000 |