On Target NA_A-H3N8 0.17289719/CHEMBL4288395
For the given ligand Brequinar, we have found in our database that, being scored 0.17289719, the most similar ligand is CHEMBL4288395. Check out the elaboration below.
| Brequinar (Given Ligand) | CHEMBL4288395 (Similar Ligand) |
|---|---|
| Cc4c(c2ccc(c1ccccc1F)cc2)nc3ccc(F)cc3c4C(=O)O | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(-c3ccc(SC)cc3)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 00002002 00001801 00104100 12010210 00041020 0000c030 00000000 00080004 00400100 10000840 00008004 50008800 80008800 00609000 20220040 0a0c000d 00020200 02003204 04200000 50500000 40000000 08028a28 30800000 80400004 00040000 80000000 08000040 00000041 10414004 00028400 c0040800 00000220 | 00072040 09807200 00120100 84110700 00180080 00000800 02080180 3a00140e 11000100 001108c8 40200000 61019001 8402881a 01892000 00001408 00081008 14a24000 02000060 64c12010 10000201 80000020 38048e80 13808080 02500019 10001401 c0001400 00c04000 90000041 0c004300 00060401 24060000 00810a30 |