On Target NA_A-H3N8 0.19666667/CHEMBL4288395
For the given ligand Sofosbuvir, we have found in our database that, being scored 0.19666667, the most similar ligand is CHEMBL4288395. Check out the elaboration below.
| Sofosbuvir (Given Ligand) | CHEMBL4288395 (Similar Ligand) |
|---|---|
| CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@H]2O[C@@H](n1ccc(=O)[nH]c1=O)[C@](C)(F)[C@@H]2O)Oc3ccccc3 | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(-c3ccc(SC)cc3)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 00200002 01540108 38100910 83010f40 40180074 00084140 02024413 80000020 0f004100 818008f4 0c00100c 4845b168 00009002 03ca0130 00a89080 009c8a8c 002a0030 00008001 29c60000 00025043 a00801a0 1e000a10 27800041 08700010 10040400 c0202002 2f0012a0 10078060 22005281 09460034 55680020 20139684 | 00072040 09807200 00120100 84110700 00180080 00000800 02080180 3a00140e 11000100 001108c8 40200000 61019001 8402881a 01892000 00001408 00081008 14a24000 02000060 64c12010 10000201 80000020 38048e80 13808080 02500019 10001401 c0001400 00c04000 90000041 0c004300 00060401 24060000 00810a30 |