On Target PLP_SARS 0.33974358/CHEMBL225515
For the given ligand Brequinar, we have found in our database that, being scored 0.33974358, the most similar ligand is CHEMBL225515. Check out the elaboration below.
| Brequinar (Given Ligand) | CHEMBL225515 (Similar Ligand) |
|---|---|
| Cc4c(c2ccc(c1ccccc1F)cc2)nc3ccc(F)cc3c4C(=O)O | O=C(Oc1cncc(Cl)c1)c1cc2ccccc2[nH]1 |
|
|
|
|
|
|
| 00002002 00001801 00104100 12010210 00041020 0000c030 00000000 00080004 00400100 10000840 00008004 50008800 80008800 00609000 20220040 0a0c000d 00020200 02003204 04200000 50500000 40000000 08028a28 30800000 80400004 00040000 80000000 08000040 00000041 10414004 00028400 c0040800 00000220 | 04008002 00000808 62024108 10010200 00041020 04004044 80080000 01200000 00000300 00000840 00080004 40048800 0680880c 08510002 01030042 020c000c 04028000 02802004 00200008 00020000 40000000 08068b68 b0802002 80c09104 00002c00 80182200 00000200 00000000 00000204 00020001 c0040200 10020000 |