On Target PLP_SARS 0.37062937/CHEMBL358279
For the given ligand Niclosamide, we have found in our database that, being scored 0.37062937, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| Niclosamide (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| O=C(Nc1ccc(N(=O)=O)cc1Cl)c2cc(Cl)ccc2O | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 0000c002 08001808 20000100 00010e00 00000100 00020000 0e000000 0a001400 04000000 00000868 04280004 4000c800 02018806 00100001 80100040 00002008 10040000 02000000 08000000 00020000 40100000 08068700 20012000 00410004 00002000 c0000400 00100000 800000a0 00008100 00060801 84040000 00020200 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |