On Target PA_INFA 0.2672414/CHEMBL3600947
For the given ligand Policresulen, we have found in our database that, being scored 0.2672414, the most similar ligand is CHEMBL3600947. Check out the elaboration below.
| Policresulen (Given Ligand) | CHEMBL3600947 (Similar Ligand) |
|---|---|
| Cc1cc(O)c(S(=O)(=O)O)cc1Cc3cc(S(=O)(=O)O)c(O)c(Cc2cc(S(=O)(=O)O)c(O)cc2C)c3C | O=C(COc1ccc(F)cc1)c1ccc(O)c(O)c1O |
|
|
|
|
|
|
| 00000000 40801008 20002102 00d10200 00000101 00010000 02000400 01000200 04800800 00080840 08002000 60008200 00000002 00200002 80200280 00082008 00000200 02000000 00008000 00022200 80000000 08000000 00004028 08400018 00008000 a0000000 00120000 40800020 02000080 00020002 02000000 00010420 | 04001001 42000808 20110109 02010200 00001041 02020010 02000000 00000240 00000000 00080840 08040000 4000c100 00808002 00001000 01040001 2008a008 08000000 82000000 04000000 00420a00 00000000 08020200 01001000 00400014 00000000 80000000 00120008 00000001 00000200 00028002 80000000 00000600 |