On Target NS5B_HCV2A 0.17679559/CHEMBL4203791
For the given ligand Policresulen, we have found in our database that, being scored 0.17679559, the most similar ligand is CHEMBL4203791. Check out the elaboration below.
| Policresulen (Given Ligand) | CHEMBL4203791 (Similar Ligand) |
|---|---|
| Cc1cc(O)c(S(=O)(=O)O)cc1Cc3cc(S(=O)(=O)O)c(O)c(Cc2cc(S(=O)(=O)O)c(O)cc2C)c3C | COC(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)Nc1ccc([C@@H]2CC[C@@H](c3ccc(NC(=O)[C@@H]4CCCN4C(=O)[C@@H](NC(=O)OC)C(C)C)cc3)N2c2ccc([Si](C)(C)C(C)(C)C)cc2)cc1)C(C)C |
|
|
|
|
|
|
| 00000000 40801008 20002102 00d10200 00000101 00010000 02000400 01000200 04800800 00080840 08002000 60008200 00000002 00200002 80200280 00082008 00000200 02000000 00008000 00022200 80000000 08000000 00004028 08400018 00008000 a0000000 00120000 40800020 02000080 00020002 02000000 00010420 | 00014002 01003800 00500122 c4010600 20000000 0001a010 00000420 22001008 00980a20 00080ac0 08380004 4021f000 0e008812 0030a001 80020440 00120088 00062000 020c0000 88022090 08000201 40100100 38048e38 20052003 0250001a 00000000 e0000002 00000000 900000a0 08008382 00068003 a0044000 00006600 |