On Target RT_HIV1 0.28275862/CHEMBL4225004
For the given ligand Policresulen, we have found in our database that, being scored 0.28275862, the most similar ligand is CHEMBL4225004. Check out the elaboration below.
| Policresulen (Given Ligand) | CHEMBL4225004 (Similar Ligand) |
|---|---|
| Cc1cc(O)c(S(=O)(=O)O)cc1Cc3cc(S(=O)(=O)O)c(O)c(Cc2cc(S(=O)(=O)O)c(O)cc2C)c3C | C=C(C)[C@@H]1CC[C@]2(CNCCc3ccc(S(N)(=O)=O)cc3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00000000 40801008 20002102 00d10200 00000101 00010000 02000400 01000200 04800800 00080840 08002000 60008200 00000002 00200002 80200280 00082008 00000200 02000000 00008000 00022200 80000000 08000000 00004028 08400018 00008000 a0000000 00120000 40800020 02000080 00020002 02000000 00010420 | 00000010 01801800 01100302 40b50600 00000008 00004000 80000080 20000402 00000980 001808c0 08302000 60018800 00028002 00200001 80200402 00080008 00000400 02000020 02012000 00002201 81000100 18260a30 00008020 8950001c 01200000 80000000 00406000 d0000028 04400002 21060002 e4020000 00012620 |