On Target NS5B_HCV1B 0.1902439/CHEMBL3645203
For the given ligand Policresulen, we have found in our database that, being scored 0.1902439, the most similar ligand is CHEMBL3645203. Check out the elaboration below.
| Policresulen (Given Ligand) | CHEMBL3645203 (Similar Ligand) |
|---|---|
| Cc1cc(O)c(S(=O)(=O)O)cc1Cc3cc(S(=O)(=O)O)c(O)c(Cc2cc(S(=O)(=O)O)c(O)cc2C)c3C | CNC(=O)c1c2cc(C3CC3)c(N(C)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00000000 40801008 20002102 00d10200 00000101 00010000 02000400 01000200 04800800 00080840 08002000 60008200 00000002 00200002 80200280 00082008 00000200 02000000 00008000 00022200 80000000 08000000 00004028 08400018 00008000 a0000000 00120000 40800020 02000080 00020002 02000000 00010420 | 00004006 0080de08 20080902 40310e00 010c0000 00004002 02040000 02001408 00100900 000908c0 09312024 40118800 80008c33 01400201 800a0040 000e200c 04268000 02000004 08600008 00224201 c0000101 1c838e38 2080c800 8360001c 00104080 c0000040 00270080 8000108c 0c408104 0046004b c4048088 a81147e0 |