On Target NSP15_SARS 0.17721519/CHEMBL2441741
For the given ligand Policresulen, we have found in our database that, being scored 0.17721519, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| Policresulen (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| Cc1cc(O)c(S(=O)(=O)O)cc1Cc3cc(S(=O)(=O)O)c(O)c(Cc2cc(S(=O)(=O)O)c(O)cc2C)c3C | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00000000 40801008 20002102 00d10200 00000101 00010000 02000400 01000200 04800800 00080840 08002000 60008200 00000002 00200002 80200280 00082008 00000200 02000000 00008000 00022200 80000000 08000000 00004028 08400018 00008000 a0000000 00120000 40800020 02000080 00020002 02000000 00010420 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |