On Target PLP_SARS 0.23140496/CHEMBL212454
For the given ligand Policresulen, we have found in our database that, being scored 0.23140496, the most similar ligand is CHEMBL212454. Check out the elaboration below.
| Policresulen (Given Ligand) | CHEMBL212454 (Similar Ligand) |
|---|---|
| Cc1cc(O)c(S(=O)(=O)O)cc1Cc3cc(S(=O)(=O)O)c(O)c(Cc2cc(S(=O)(=O)O)c(O)cc2C)c3C | O=C(Oc1ccc(S(=O)(=O)c2ccc(OC(=O)C(Cl)=C(Cl)Cl)cc2)cc1)C(Cl)=C(Cl)Cl |
|
|
|
|
|
|
| 00000000 40801008 20002102 00d10200 00000101 00010000 02000400 01000200 04800800 00080840 08002000 60008200 00000002 00200002 80200280 00082008 00000200 02000000 00008000 00022200 80000000 08000000 00004028 08400018 00008000 a0000000 00120000 40800020 02000080 00020002 02000000 00010420 | 04080000 00804228 20020008 20900200 02041000 00000080 02040080 00000400 01000000 00000840 00002000 60008000 02808002 00000100 81610001 00080008 04021000 02000000 00200410 00022000 80002000 08000b80 10800000 08000009 00000040 08000000 00800000 00000080 00000204 00020000 04000000 10030030 |