On Target E1_HCV77 0.3114754/CHEMBL4107993
For the given ligand Policresulen, we have found in our database that, being scored 0.3114754, the most similar ligand is CHEMBL4107993. Check out the elaboration below.
| Policresulen (Given Ligand) | CHEMBL4107993 (Similar Ligand) |
|---|---|
| Cc1cc(O)c(S(=O)(=O)O)cc1Cc3cc(S(=O)(=O)O)c(O)c(Cc2cc(S(=O)(=O)O)c(O)cc2C)c3C | CC[C@@H](N)c1ccc(OC)c(C(=O)c2ccccc2)c1F |
|
|
|
|
|
|
| 00000000 40801008 20002102 00d10200 00000101 00010000 02000400 01000200 04800800 00080840 08002000 60008200 00000002 00200002 80200280 00082008 00000200 02000000 00008000 00022200 80000000 08000000 00004028 08400018 00008000 a0000000 00120000 40800020 02000080 00020002 02000000 00010420 | 00000040 00000808 20100108 02010600 00001201 00020010 02040000 01001200 00000800 00088e40 08100000 40008200 00008842 00001000 01000001 08082008 03000200 02000000 00000400 00020001 00000100 18028200 01000000 12400014 00000000 e0000000 08320800 40800001 00000380 00068002 82040010 00000600 |