On Target RT_HIV1 0.31102362/CHEMBL3943252
For the given ligand Carnosine, we have found in our database that, being scored 0.31102362, the most similar ligand is CHEMBL3943252. Check out the elaboration below.
| Carnosine (Given Ligand) | CHEMBL3943252 (Similar Ligand) |
|---|---|
| NCCC(=O)N[C@@H](Cc1cnc[nH]1)C(=O)O | CC(C)CN(C(CO)c1ccc(CNC(=O)C(NC(=O)c2ccccc2)C(c2ccccc2)c2cnc[nH]2)s1)S(=O)(=O)c1ccc2ncsc2c1 |
|
|
|
|
|
|
| 04000002 00005400 00100000 01800410 040000c0 00000000 00002000 0000000c 00400980 00090300 20208000 50013800 0e008002 00100800 810a0000 000c000c 10000000 0e000000 00400018 40000201 00000c00 10200e00 230000c0 10000018 00041001 00000200 00000000 00000000 04000004 00460011 60004000 20002200 | 0c038012 10803a00 03180108 05b10611 140c02c0 000a8000 040068a1 2700d00e 00460980 00491ac0 2930aa04 f000b880 8620a832 00542821 816e24c0 000c160c 18413020 0e11008d 00700018 40006e0d e0001d00 782a8680 23900200 db41005c 42041800 cc010304 40000800 d000210c 0c200784 2046000f e0044000 20c107e0 |