On Target NS5B_HCV1A 0.3642384/CHEMBL13256
For the given ligand Carnosine, we have found in our database that, being scored 0.3642384, the most similar ligand is CHEMBL13256. Check out the elaboration below.
| Carnosine (Given Ligand) | CHEMBL13256 (Similar Ligand) |
|---|---|
| NCCC(=O)N[C@@H](Cc1cnc[nH]1)C(=O)O | CC[C@H](NC(=O)[C@H](CC1CCCCC1)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)c1cnccn1)[C@@H](C)CC)C(=O)C(=O)NCC(=O)O |
|
|
|
|
|
|
| 04000002 00005400 00100000 01800410 040000c0 00000000 00002000 0000000c 00400980 00090300 20208000 50013800 0e008002 00100800 810a0000 000c000c 10000000 0e000000 00400018 40000201 00000c00 10200e00 230000c0 10000018 00041001 00000200 00000000 00000000 04000004 00460011 60004000 20002200 | 10018002 01807400 00100800 14000c10 000000c0 00100000 0000c000 20003009 14000000 000101a0 01292000 40013000 0e00800a 00102003 808a0400 000c010c 18020000 02000003 02002010 00000201 80000000 300f8e10 23004003 02100018 00141000 00000000 08000000 90000004 08000004 00060811 a0024000 80002200 |