On Target NS5B_HCV1B 0.23275863/CHEMBL3645205
For the given ligand Carnosine, we have found in our database that, being scored 0.23275863, the most similar ligand is CHEMBL3645205. Check out the elaboration below.
| Carnosine (Given Ligand) | CHEMBL3645205 (Similar Ligand) |
|---|---|
| NCCC(=O)N[C@@H](Cc1cnc[nH]1)C(=O)O | CNC(=O)c1c2cc(C3CC3)c(N(CCC(=O)OC)S(C)(=O)=O)cc2nn1-c1ccc(F)cc1 |
|
|
|
|
|
|
| 04000002 00005400 00100000 01800410 040000c0 00000000 00002000 0000000c 00400980 00090300 20208000 50013800 0e008002 00100800 810a0000 000c000c 10000000 0e000000 00400018 40000201 00000c00 10200e00 230000c0 10000018 00041001 00000200 00000000 00000000 04000004 00460011 60004000 20002200 | 00004006 00805e08 20180902 43310e00 210c0000 00004052 22040000 02001408 00100900 004908c0 09312034 50119800 88008c23 01401201 810a0040 000e200e 0426c004 02400004 08e00018 00224205 c0100101 1c838e38 21801880 9360001c 02104080 c0000040 00270080 8000108d 0c488304 0046804b c4048080 a01147e0 |