On Target NA_INFB 0.42307693/CHEMBL195288
For the given ligand Carnosine, we have found in our database that, being scored 0.42307693, the most similar ligand is CHEMBL195288. Check out the elaboration below.
| Carnosine (Given Ligand) | CHEMBL195288 (Similar Ligand) |
|---|---|
| NCCC(=O)N[C@@H](Cc1cnc[nH]1)C(=O)O | CC(=O)N[C@@H](CC(C)C)[C@@H]1N[C@@H](C(=O)O)C[C@H]1c1ncc[nH]1 |
|
|
|
|
|
|
| 04000002 00005400 00100000 01800410 040000c0 00000000 00002000 0000000c 00400980 00090300 20208000 50013800 0e008002 00100800 810a0000 000c000c 10000000 0e000000 00400018 40000201 00000c00 10200e00 230000c0 10000018 00041001 00000200 00000000 00000000 04000004 00460011 60004000 20002200 | 0401000a 01003000 00100420 14000400 000800c0 00000010 01000020 20000008 00000100 00000280 00208000 40013000 0600801a 01802001 811a0000 000c000c 10000000 0c000000 00402008 00000201 20100000 30040e30 23000001 02100018 00001000 00000000 00000000 10000180 08000004 00c60801 40024000 20802a00 |