On Target NP_HCoV-OC43 0.13235295/CHEMBL3233481
For the given ligand Carnosine, we have found in our database that, being scored 0.13235295, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Carnosine (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| NCCC(=O)N[C@@H](Cc1cnc[nH]1)C(=O)O | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 04000002 00005400 00100000 01800410 040000c0 00000000 00002000 0000000c 00400980 00090300 20208000 50013800 0e008002 00100800 810a0000 000c000c 10000000 0e000000 00400018 40000201 00000c00 10200e00 230000c0 10000018 00041001 00000200 00000000 00000000 04000004 00460011 60004000 20002200 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |