On Target PLP_SARS 0.25301206/CHEMBL213054
For the given ligand Carnosine, we have found in our database that, being scored 0.25301206, the most similar ligand is CHEMBL213054. Check out the elaboration below.
| Carnosine (Given Ligand) | CHEMBL213054 (Similar Ligand) |
|---|---|
| NCCC(=O)N[C@@H](Cc1cnc[nH]1)C(=O)O | CC(OC(C)(C)C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC1CCCCC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 04000002 00005400 00100000 01800410 040000c0 00000000 00002000 0000000c 00400980 00090300 20208000 50013800 0e008002 00100800 810a0000 000c000c 10000000 0e000000 00400018 40000201 00000c00 10200e00 230000c0 10000018 00041001 00000200 00000000 00000000 04000004 00460011 60004000 20002200 | 01030000 01407000 00100100 84010600 00040080 0023c010 00000000 20000008 00a00300 000208c0 00200000 4003b000 1e00801a 00092001 80001008 021a0008 00220000 02080400 02802890 01000201 00000020 38040e30 13000083 02500018 00000401 80002002 00800800 10200020 08000200 00060001 e0024000 00802200 |