On Target PR_FCoV 0.13942307/CHEMBL4214471
For the given ligand Erlotinib, we have found in our database that, being scored 0.13942307, the most similar ligand is CHEMBL4214471. Check out the elaboration below.
| Erlotinib (Given Ligand) | CHEMBL4214471 (Similar Ligand) |
|---|---|
| C#Cc3cccc(Nc1ncnc2cc(OCCOC)c(OCCOC)cc12)c3 | CC(C)C[C@H](NC(=O)OC1(Cc2ccccc2)CCN(S(C)(=O)=O)CC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 04000002 00004008 20000908 08290600 00443000 00004000 06088010 00000808 00002100 00000850 01300004 40009800 04804027 00400000 01200041 020c800c 00040000 12004008 0860000a 10260400 41000000 08040028 24804040 0a400000 00042004 80000000 02040000 00800080 00408208 00460008 40000000 002001c0 | 00030000 01403000 00100102 05310600 00000040 00018010 20000001 20000048 00b00a00 004a08c0 08302000 5003b000 0e00801a 00202101 81440000 001a0008 08220000 02480000 04802810 00004205 00000100 38040e70 01000081 12500018 02000001 80041002 00000000 1020002c 08000200 00060007 a0004000 00812670 |