On Target PR_FCoV 0.19844358/CHEMBL4214471
For the given ligand Sunitinib, we have found in our database that, being scored 0.19844358, the most similar ligand is CHEMBL4214471. Check out the elaboration below.
| Sunitinib (Given Ligand) | CHEMBL4214471 (Similar Ligand) |
|---|---|
| CCN(CC)CCNC(=O)c3c(C)[nH]c(C=c1c(=O)[nH]c2ccc(F)cc12)c3C | CC(C)C[C@H](NC(=O)OC1(Cc2ccccc2)CCN(S(C)(=O)=O)CC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 10084202 0080b800 00100180 16010e10 21000021 04008010 90204080 0802540c 01800100 28492850 09280104 70009008 01008002 0031b002 c00205c2 0844000c 24060408 12000104 08218000 00a00000 c1120000 38308e00 20822800 8341011d 00044004 c2000201 88406010 c0011281 0c60c104 00268003 a400a200 a0000620 | 00030000 01403000 00100102 05310600 00000040 00018010 20000001 20000048 00b00a00 004a08c0 08302000 5003b000 0e00801a 00202101 81440000 001a0008 08220000 02480000 04802810 00004205 00000100 38040e70 01000081 12500018 02000001 80041002 00000000 1020002c 08000200 00060007 a0004000 00812670 |