On Target NS3_HCV1B 0.21594684/CHEMBL297884
For the given ligand Erlotinib, we have found in our database that, being scored 0.21594684, the most similar ligand is CHEMBL297884. Check out the elaboration below.
| Erlotinib (Given Ligand) | CHEMBL297884 (Similar Ligand) |
|---|---|
| C#Cc3cccc(Nc1ncnc2cc(OCCOC)c(OCCOC)cc12)c3 | COc1ccc2c(O[C@@H]3C[C@H]4C(=O)N[C@]5(C(=O)O)C[C@H]5/C=C\CCCCC[C@H](NC(=O)OC5CCCC5)C(=O)N4C3)cc(-c3csc(NC(C)C)n3)nc2c1 |
|
|
|
|
|
|
| 04000002 00004008 20000908 08290600 00443000 00004000 06088010 00000808 00002100 00000850 01300004 40009800 04804027 00400000 01200041 020c800c 00040000 12004008 0860000a 10260400 41000000 08040028 24804040 0a400000 00042004 80000000 02040000 00800080 00408208 00460008 40000000 002001c0 | 04072002 c9427008 a0104908 14810702 211c10a0 02118050 c6080100 b00a848a 10800300 2010c8ca 00202a04 5101b420 0e82881a 01502183 911a3441 021e200c 10a24000 120861c4 44e82818 12e63a01 40080000 3914aef8 f390c883 82510018 00a01081 8c101002 00e04240 90200465 0c00420c 850e2403 e4065800 04252a42 |