On Target GP_EBOV 0.3480392/CHEMBL4640931
For the given ligand Sunitinib, we have found in our database that, being scored 0.3480392, the most similar ligand is CHEMBL4640931. Check out the elaboration below.
| Sunitinib (Given Ligand) | CHEMBL4640931 (Similar Ligand) |
|---|---|
| CCN(CC)CCNC(=O)c3c(C)[nH]c(C=c1c(=O)[nH]c2ccc(F)cc12)c3C | CC(c1ccc(C(=O)N2CCc3cc(C(C)(C)C)ccc32)cc1)N1CCCCC1 |
|
|
|
|
|
|
| 10084202 0080b800 00100180 16010e10 21000021 04008010 90204080 0802540c 01800100 28492850 09280104 70009008 01008002 0031b002 c00205c2 0844000c 24060408 12000104 08218000 00a00000 c1120000 38308e00 20822800 8341011d 00044004 c2000201 88406010 c0011281 0c60c104 00268003 a400a200 a0000620 | 00004002 01001800 00100100 40010600 20001001 00000040 00000000 22001004 00000180 000808c0 08280024 5001c800 80008802 00108000 00020540 00080008 00048000 02000000 08000000 00000201 40100000 18228600 20012000 8154001d 00000000 c0000000 00000010 90801080 04088100 00060003 a0040000 20000600 |