On Target PR_HIV1 0.17894737/CHEMBL517126
For the given ligand Sunitinib, we have found in our database that, being scored 0.17894737, the most similar ligand is CHEMBL517126. Check out the elaboration below.
| Sunitinib (Given Ligand) | CHEMBL517126 (Similar Ligand) |
|---|---|
| CCN(CC)CCNC(=O)c3c(C)[nH]c(C=c1c(=O)[nH]c2ccc(F)cc12)c3C | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CCOCOC2)cc1 |
|
|
|
|
|
|
| 10084202 0080b800 00100180 16010e10 21000021 04008010 90204080 0802540c 01800100 28492850 09280104 70009008 01008002 0031b002 c00205c2 0844000c 24060408 12000104 08218000 00a00000 c1120000 38308e00 20822800 8341011d 00044004 c2000201 88406010 c0011281 0c60c104 00268003 a400a200 a0000620 | 00000010 01c05409 2110050a 01b10700 00281080 00028000 02002800 28000004 00742a00 014809e0 08302000 60018010 00008002 00200101 81e80001 003a0008 10022000 02080000 11408800 01027603 80100100 18280c90 07100040 d9500058 02000000 8000100e 00800000 342100cc 04000600 2006001b 80a00000 00012670 |