On Target NS5B_HCV2A 0.17435898/CHEMBL3127326
For the given ligand Erlotinib, we have found in our database that, being scored 0.17435898, the most similar ligand is CHEMBL3127326. Check out the elaboration below.
| Erlotinib (Given Ligand) | CHEMBL3127326 (Similar Ligand) |
|---|---|
| C#Cc3cccc(Nc1ncnc2cc(OCCOC)c(OCCOC)cc12)c3 | COC(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)Nc1ccc([C@@H]2CC[C@@H](c3ccc(NC(=O)[C@@H]4CCCN4C(=O)[C@@H](NC(=O)OC)C(C)C)cc3)N2c2ccc(C(C)(C)C)cc2)cc1)C(C)C |
|
|
|
|
|
|
| 04000002 00004008 20000908 08290600 00443000 00004000 06088010 00000808 00002100 00000850 01300004 40009800 04804027 00400000 01200041 020c800c 00040000 12004008 0860000a 10260400 41000000 08040028 24804040 0a400000 00042004 80000000 02040000 00800080 00408208 00460008 40000000 002001c0 | 00014002 01003800 00100122 c4010600 20000000 0001a010 00000000 22001008 00900a00 00080ac0 08380004 4001f000 0e008812 0030a001 80020440 00120008 00062000 02080000 08002010 00000201 40100100 38048e30 20012003 0250001a 00000000 c0000002 00000000 900000a0 08008302 00060003 a0044000 00002600 |