On Target NS5B_HCV1B 0.35/CHEMBL3645196
For the given ligand Sunitinib, we have found in our database that, being scored 0.35, the most similar ligand is CHEMBL3645196. Check out the elaboration below.
| Sunitinib (Given Ligand) | CHEMBL3645196 (Similar Ligand) |
|---|---|
| CCN(CC)CCNC(=O)c3c(C)[nH]c(C=c1c(=O)[nH]c2ccc(F)cc12)c3C | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)c3nonc3C)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 10084202 0080b800 00100180 16010e10 21000021 04008010 90204080 0802540c 01800100 28492850 09280104 70009008 01008002 0031b002 c00205c2 0844000c 24060408 12000104 08218000 00a00000 c1120000 38308e00 20822800 8341011d 00044004 c2000201 88406010 c0011281 0c60c104 00268003 a400a200 a0000620 | 00886086 0080de08 20180902 53310e10 230c0000 0000c042 22044000 02003408 00140900 004969e0 09312024 40118800 80008c73 01601209 808a0460 000e300e 06268200 02000004 0c600008 00225203 e1120121 1c8b8e38 2180e800 b360001c 02104090 c0000049 00274080 8001108e 0c488104 0046005b e4048088 a81147e0 |