On Target NA_INFB 0.27237353/CHEMBL4175983
For the given ligand Sunitinib, we have found in our database that, being scored 0.27237353, the most similar ligand is CHEMBL4175983. Check out the elaboration below.
| Sunitinib (Given Ligand) | CHEMBL4175983 (Similar Ligand) |
|---|---|
| CCN(CC)CCNC(=O)c3c(C)[nH]c(C=c1c(=O)[nH]c2ccc(F)cc12)c3C | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(N3CCCC3)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 10084202 0080b800 00100180 16010e10 21000021 04008010 90204080 0802540c 01800100 28492850 09280104 70009008 01008002 0031b002 c00205c2 0844000c 24060408 12000104 08218000 00a00000 c1120000 38308e00 20822800 8341011d 00044004 c2000201 88406010 c0011281 0c60c104 00268003 a400a200 a0000620 | 00074042 09007800 00100100 84010700 20180080 00002810 02080180 3a00140a 11000000 001108c8 40200004 41019001 0402881a 0188a000 00021448 00081008 10a44000 02000060 68c12010 00000201 40100020 38048e80 33008080 02500018 10001401 c0001400 00c04000 90000081 0c008300 00060401 24060000 00800a10 |