On Target CAPSD_HCV77 0.38148147/CHEMBL3908382
For the given ligand Sunitinib, we have found in our database that, being scored 0.38148147, the most similar ligand is CHEMBL3908382. Check out the elaboration below.
| Sunitinib (Given Ligand) | CHEMBL3908382 (Similar Ligand) |
|---|---|
| CCN(CC)CCNC(=O)c3c(C)[nH]c(C=c1c(=O)[nH]c2ccc(F)cc12)c3C | CC(C)c1ccc2c(Nc3cc(C#Cc4ccc(NC(=O)[C@@H]5CCCN5C(=O)[C@@H](c5ccccc5)N(C)C)cc4)ccc3Sc3ccc(N)cc3)ncnc2n1 |
|
|
|
|
|
|
| 10084202 0080b800 00100180 16010e10 21000021 04008010 90204080 0802540c 01800100 28492850 09280104 70009008 01008002 0031b002 c00205c2 0844000c 24060408 12000104 08218000 00a00000 c1120000 38308e00 20822800 8341011d 00044004 c2000201 88406010 c0011281 0c60c104 00268003 a400a200 a0000620 | 1001420a 01827a00 001a4920 1c190600 24442020 00006010 00009010 22001808 10002180 00080ad0 08399004 6081b800 07008813 0091a001 c0020440 1a0c0006 04041000 72004000 0860000a 12200201 c1100000 38a48660 20806043 8358001f 00044004 80000200 02a080d0 90800080 0e40830c 01460003 e004e000 200126e0 |