On Target PLP_SARS 0.37320575/CHEMBL358279
For the given ligand Sunitinib, we have found in our database that, being scored 0.37320575, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| Sunitinib (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| CCN(CC)CCNC(=O)c3c(C)[nH]c(C=c1c(=O)[nH]c2ccc(F)cc12)c3C | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 10084202 0080b800 00100180 16010e10 21000021 04008010 90204080 0802540c 01800100 28492850 09280104 70009008 01008002 0031b002 c00205c2 0844000c 24060408 12000104 08218000 00a00000 c1120000 38308e00 20822800 8341011d 00044004 c2000201 88406010 c0011281 0c60c104 00268003 a400a200 a0000620 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |