On Target DPM_HHV1K 0.11382114/CHEMBL29711
For the given ligand Ivermectin 01, we have found in our database that, being scored 0.11382114, the most similar ligand is CHEMBL29711. Check out the elaboration below.
| Ivermectin 01 (Given Ligand) | CHEMBL29711 (Similar Ligand) |
|---|---|
| CCC(C)C1OC7(CCC1C)CC4CC(C/C=C(C)/C(OC3CC(OC)C(OC2CC(OC)C(O)C(C)O2)C(C)O3)C(C)/C=C/C=C/5COC6C(O)/C(C)=C\C(C(=O)O4)C56O)O7 | C[C@]12CC[C@@H](O)[C@@](C)(CO)[C@@H]1CC[C@H]1C[C@@H]3C[C@@]12CC[C@]3(O)CO |
|
|
|
|
|
|
| 00050040 81040000 02800900 80810300 c0290140 00800801 02002840 28000442 00202040 01100028 40000200 40409000 1c028028 02820000 00080404 0028900c 00820000 00000120 3140a090 0200a001 00100020 10001a00 0540a000 08000012 00201400 00000400 00404202 a4000020 00000240 8000000a 24a20000 04000010 | 00000000 01000000 00000000 00000000 00080000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00800000 00000000 00080008 00000000 00000000 03402000 00000001 00000000 00000000 05000000 00000010 00000000 00000000 00000000 00001000 00000000 01000000 00020000 00000000 |