On Target GP_EBOV 0.27586207/CHEMBL3125897
For the given ligand Ivermectin 01, we have found in our database that, being scored 0.27586207, the most similar ligand is CHEMBL3125897. Check out the elaboration below.
| Ivermectin 01 (Given Ligand) | CHEMBL3125897 (Similar Ligand) |
|---|---|
| CCC(C)C1OC7(CCC1C)CC4CC(C/C=C(C)/C(OC3CC(OC)C(OC2CC(OC)C(O)C(C)O2)C(C)O3)C(C)/C=C/C=C/5COC6C(O)/C(C)=C\C(C(=O)O4)C56O)O7 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OC(=O)CSC[C@H](NC(=O)CNC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CCCCN)C(=O)O)CC[C@]4(C)[C@H]3CC[C@@]21C |
|
|
|
|
|
|
| 00050040 81040000 02800900 80810300 c0290140 00800801 02002840 28000442 00202040 01100028 40000200 40409000 1c028028 02820000 00080404 0028900c 00820000 00000120 3140a090 0200a001 00100020 10001a00 0540a000 08000012 00201400 00000400 00404202 a4000020 00000240 8000000a 24a20000 04000010 | 00010000 41007000 20120921 0c110700 00090080 00000020 00000000 2000040a 00000000 02144088 00203200 4001b000 1603800e 80842101 80100414 00081008 14820000 00000020 02c02000 00408301 00000020 30041e32 0300a683 06100018 18218601 00000010 00406000 90002040 08001200 01040023 24024000 07012200 |