On Target NS5B_HCV1A 0.18518518/CHEMBL3644897
For the given ligand Ivermectin 01, we have found in our database that, being scored 0.18518518, the most similar ligand is CHEMBL3644897. Check out the elaboration below.
| Ivermectin 01 (Given Ligand) | CHEMBL3644897 (Similar Ligand) |
|---|---|
| CCC(C)C1OC7(CCC1C)CC4CC(C/C=C(C)/C(OC3CC(OC)C(OC2CC(OC)C(O)C(C)O2)C(C)O3)C(C)/C=C/C=C/5COC6C(O)/C(C)=C\C(C(=O)O4)C56O)O7 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CN(S(=O)(=O)c2cccs2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 00050040 81040000 02800900 80810300 c0290140 00800801 02002840 28000442 00202040 01100028 40000200 40409000 1c028028 02820000 00080404 0028900c 00820000 00000120 3140a090 0200a001 00100020 10001a00 0540a000 08000012 00201400 00000400 00404202 a4000020 00000240 8000000a 24a20000 04000010 | 00010090 0d403400 01300900 07b90f00 00080000 00018000 0c0a0004 a0003408 10800240 0052a9a8 00202610 e001b480 0e00f206 01062141 80c00400 001a800c 02826014 00082000 40e108d0 00007603 00002100 fc050e90 01002003 3a040238 02012000 2402300e 80000000 9021042c 08800600 a5060093 a4184022 01c12270 |