On Target NA_INFB 0.3218391/CHEMBL81777
For the given ligand Ivermectin 01, we have found in our database that, being scored 0.3218391, the most similar ligand is CHEMBL81777. Check out the elaboration below.
| Ivermectin 01 (Given Ligand) | CHEMBL81777 (Similar Ligand) |
|---|---|
| CCC(C)C1OC7(CCC1C)CC4CC(C/C=C(C)/C(OC3CC(OC)C(OC2CC(OC)C(O)C(C)O2)C(C)O3)C(C)/C=C/C=C/5COC6C(O)/C(C)=C\C(C(=O)O4)C56O)O7 | C=CC[C@@H](CC)O[C@@H]1C=C(C(=O)O)C[C@H](N)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 00050040 81040000 02800900 80810300 c0290140 00800801 02002840 28000442 00202040 01100028 40000200 40409000 1c028028 02820000 00080404 0028900c 00820000 00000120 3140a090 0200a001 00100020 10001a00 0540a000 08000012 00201400 00000400 00404202 a4000020 00000240 8000000a 24a20000 04000010 | 00070040 09007000 00100000 80010500 00180080 00000800 02080180 38000402 11000000 00100088 40200000 41019001 0402801a 01880000 0000140c 00081008 10a04000 00000060 60c12010 00008201 00000020 30041e80 13008000 02100018 10001400 00001400 00c04000 90000001 0c000200 00040401 04020000 00000210 |