On Target NP_HCoV-OC43 0.057471264/CHEMBL3233481
For the given ligand Ivermectin 01, we have found in our database that, being scored 0.057471264, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Ivermectin 01 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CCC(C)C1OC7(CCC1C)CC4CC(C/C=C(C)/C(OC3CC(OC)C(OC2CC(OC)C(O)C(C)O2)C(C)O3)C(C)/C=C/C=C/5COC6C(O)/C(C)=C\C(C(=O)O4)C56O)O7 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00050040 81040000 02800900 80810300 c0290140 00800801 02002840 28000442 00202040 01100028 40000200 40409000 1c028028 02820000 00080404 0028900c 00820000 00000120 3140a090 0200a001 00100020 10001a00 0540a000 08000012 00201400 00000400 00404202 a4000020 00000240 8000000a 24a20000 04000010 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |