On Target PLP_SARS 0.2283105/CHEMBL212080
For the given ligand Ivermectin 01, we have found in our database that, being scored 0.2283105, the most similar ligand is CHEMBL212080. Check out the elaboration below.
| Ivermectin 01 (Given Ligand) | CHEMBL212080 (Similar Ligand) |
|---|---|
| CCC(C)C1OC7(CCC1C)CC4CC(C/C=C(C)/C(OC3CC(OC)C(OC2CC(OC)C(O)C(C)O2)C(C)O3)C(C)/C=C/C=C/5COC6C(O)/C(C)=C\C(C(=O)O4)C56O)O7 | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)OC(C)(C)C |
|
|
|
|
|
|
| 00050040 81040000 02800900 80810300 c0290140 00800801 02002840 28000442 00202040 01100028 40000200 40409000 1c028028 02820000 00080404 0028900c 00820000 00000120 3140a090 0200a001 00100020 10001a00 0540a000 08000012 00201400 00000400 00404202 a4000020 00000240 8000000a 24a20000 04000010 | 01030000 0140f000 00100100 84010600 00040080 0023c810 02100080 28000408 01a00300 001088c0 40200000 4003b000 1e028002 00092001 80001408 021a0008 20220000 02080500 20812890 01001201 00002020 38040fb0 13008083 02500018 00001401 8800ac02 00c84800 90200120 08000200 00060001 ec004000 02802210 |