On Target RT_HIV1 0.28787878/CHEMBL4228598
For the given ligand C1, we have found in our database that, being scored 0.28787878, the most similar ligand is CHEMBL4228598. Check out the elaboration below.
| C1 (Given Ligand) | CHEMBL4228598 (Similar Ligand) |
|---|---|
| C/C(C)=C/Cc3ccc2c(=O)c1ccccc1[oH+]c2c3O | C=C(C)[C@@H]1CC[C@]2(CNCCCN)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00000000 42000c08 20000108 40018202 00001000 00820000 02000001 01000600 00040104 00980840 08000000 40008800 0000c002 20000000 01000001 2000a008 00000000 02100000 00082000 00020a00 00400000 08020300 00008000 06420014 00000000 e8000000 00400800 40200000 00000380 00020002 87020400 00000400 | 00000000 01000c00 00100302 40050600 00000000 00004000 80000080 20000402 00000900 001809c0 08300000 40018800 00028002 00200000 00000402 00080008 00000400 02000020 02012000 00000201 01000100 18020a30 00008020 00500014 01200000 80000000 00406000 d0000000 00400002 01060012 e4020000 00002600 |