On Target NA_INFB 0.19642857/CHEMBL113191
For the given ligand C1, we have found in our database that, being scored 0.19642857, the most similar ligand is CHEMBL113191. Check out the elaboration below.
| C1 (Given Ligand) | CHEMBL113191 (Similar Ligand) |
|---|---|
| C/C(C)=C/Cc3ccc2c(=O)c1ccccc1[oH+]c2c3O | CC(=O)N[C@@H]1[C@@H](N)CC(C(=O)O)=C[C@H]1N(C)CCc1ccccc1 |
|
|
|
|
|
|
| 00000000 42000c08 20000108 40018202 00001000 00820000 02000001 01000600 00040104 00980840 08000000 40008800 0000c002 20000000 01000001 2000a008 00000000 02100000 00082000 00020a00 00400000 08020300 00008000 06420014 00000000 e8000000 00400800 40200000 00000380 00020002 87020400 00000400 | 00030010 0900b400 00100100 04010600 00180000 00000000 00180180 3800040a 11000080 001809c8 08200000 41019000 0402811a 01812000 00000400 00080308 20004000 02000160 40412010 00000201 00000000 38240f90 01008001 83500018 00001000 88008c00 00484000 90000000 0c000000 00060413 04020000 02002600 |