On Target GP_EBOV 0.37777779/CHEMBL3125897
For the given ligand Narlaprevir, we have found in our database that, being scored 0.37777779, the most similar ligand is CHEMBL3125897. Check out the elaboration below.
| Narlaprevir (Given Ligand) | CHEMBL3125897 (Similar Ligand) |
|---|---|
| CCCCC(NC(=O)C1[C@@H]3[C@H](CN1C(=O)C(NC(=O)NC2(CS(=O)(=O)C(C)(C)C)CCCCC2)C(C)(C)C)C3(C)C)C(=O)C(=O)NC4CC4 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OC(=O)CSC[C@H](NC(=O)CNC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CCCCN)C(=O)O)CC[C@]4(C)[C@H]3CC[C@@]21C |
|
|
|
|
|
|
| 00010000 45003400 20100000 04100c00 00000000 00000090 00000004 20002008 04220000 020241a0 00202000 50033000 0e01b01e 01042101 c0000000 00000000 04000010 00020001 02002050 00000301 40000100 300d0631 00000303 0a3c0018 00011000 00000000 00004000 10000020 08000000 00040031 200a4000 03012220 | 00010000 41007000 20120921 0c110700 00090080 00000020 00000000 2000040a 00000000 02144088 00203200 4001b000 1603800e 80842101 80100414 00081008 14820000 00000020 02c02000 00408301 00000020 30041e32 0300a683 06100018 18218601 00000010 00406000 90002040 08001200 01040023 24024000 07012200 |