On Target PR_HIV1 0.19617225/CHEMBL492666
For the given ligand Narlaprevir, we have found in our database that, being scored 0.19617225, the most similar ligand is CHEMBL492666. Check out the elaboration below.
| Narlaprevir (Given Ligand) | CHEMBL492666 (Similar Ligand) |
|---|---|
| CCCCC(NC(=O)C1[C@@H]3[C@H](CN1C(=O)C(NC(=O)NC2(CS(=O)(=O)C(C)(C)C)CCCCC2)C(C)(C)C)C3(C)C)C(=O)C(=O)NC4CC4 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2CCCCCC2)cc1 |
|
|
|
|
|
|
| 00010000 45003400 20100000 04100c00 00000000 00000090 00000004 20002008 04220000 020241a0 00202000 50033000 0e01b01e 01042101 c0000000 00000000 04000010 00020001 02002050 00000301 40000100 300d0631 00000303 0a3c0018 00011000 00000000 00004000 10000020 08000000 00040031 200a4000 03012220 | 00000010 01c05408 2110010a 01b10700 00081080 00028000 02000000 a0000004 00540a00 004809e0 08302000 60018000 00008002 00a00101 81e80001 001a0008 10822000 02080000 00402800 01027603 80000100 18280c90 03100040 d9500058 02000000 8000100e 00800000 1020108c 04000600 20060013 80020000 00012670 |