On Target RT_HIV1 0.3/CHEMBL4224747
For the given ligand Narlaprevir, we have found in our database that, being scored 0.3, the most similar ligand is CHEMBL4224747. Check out the elaboration below.
| Narlaprevir (Given Ligand) | CHEMBL4224747 (Similar Ligand) |
|---|---|
| CCCCC(NC(=O)C1[C@@H]3[C@H](CN1C(=O)C(NC(=O)NC2(CS(=O)(=O)C(C)(C)C)CCCCC2)C(C)(C)C)C3(C)C)C(=O)C(=O)NC4CC4 | C=C(C)[C@@H]1CC[C@]2(CN(CCCN3CCS(=O)(=O)CC3)C3CC3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00010000 45003400 20100000 04100c00 00000000 00000090 00000004 20002008 04220000 020241a0 00202000 50033000 0e01b01e 01042101 c0000000 00000000 04000010 00020001 02002050 00000301 40000100 300d0631 00000303 0a3c0018 00011000 00000000 00004000 10000020 08000000 00040031 200a4000 03012220 | 00000000 45000c00 20100302 48150600 00000000 00004000 80000080 20000402 00020900 021a49e0 08302000 40018800 00028006 01240000 80000402 00080008 04000400 02010020 02012000 00000201 01000100 18020a30 00008260 04580014 01200000 80000000 00406000 d0000000 00400002 01060012 e4020000 02012620 |