On Target NA_INFB 0.38129497/CHEMBL369125
For the given ligand Narlaprevir, we have found in our database that, being scored 0.38129497, the most similar ligand is CHEMBL369125. Check out the elaboration below.
| Narlaprevir (Given Ligand) | CHEMBL369125 (Similar Ligand) |
|---|---|
| CCCCC(NC(=O)C1[C@@H]3[C@H](CN1C(=O)C(NC(=O)NC2(CS(=O)(=O)C(C)(C)C)CCCCC2)C(C)(C)C)C3(C)C)C(=O)C(=O)NC4CC4 | COC(=O)[C@@H]1C[C@H](C(=O)O)N[C@H]1[C@H](CC(C)C)NC(C)=O |
|
|
|
|
|
|
| 00010000 45003400 20100000 04100c00 00000000 00000090 00000004 20002008 04220000 020241a0 00202000 50033000 0e01b01e 01042101 c0000000 00000000 04000010 00020001 02002050 00000301 40000100 300d0631 00000303 0a3c0018 00011000 00000000 00004000 10000020 08000000 00040031 200a4000 03012220 | 00030000 01003000 00100100 04010500 00180080 00000010 00000000 20000008 00000000 00020080 00200000 4001b000 0e00803a 03802001 80180000 00080008 10a20000 00000000 00c02010 00000201 00000000 30040e30 03000081 02100018 00001001 00000000 00000200 10000000 08000200 00040001 00024000 00802a00 |